C8H12N2 — CID 123420674
N-[5-(methylideneamino)hexa-2,4-dien-2-yl]methanimine (PubChem CID 123420674) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N-[5-(methylideneamino)hexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[5-(methylideneamino)hexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 123420674 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N-[5-(methylideneamino)hexa-2,4-dien-2-yl]methanimine |
| SMILES | C=NC(C)=CC=C(C)N=C |
| InChI | InChI=1S/C8H12N2/c1-7(9-3)5-6-8(2)10-4/h5-6H,3-4H2,1-2H3 |
| InChIKey | QAOPCTFPHKDMBZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|