C7H8ClN — CID 144860153
N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidoyl chloride (PubChem CID 144860153) has the molecular formula C7H8ClN and a molecular weight of 141.60 g/mol. Its IUPAC name is N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidoyl chloride.
| Compound Name | N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidoyl chloride |
|---|---|
| PubChem CID | 144860153 |
| Molecular Formula | C7H8ClN |
| Molecular Weight | 141.60 g/mol |
| Exact Mass | 141.03 |
| IUPAC Name | N-[(3Z)-hexa-1,3,5-trien-2-yl]methanimidoyl chloride |
| SMILES | C=C/C=C\C(=C)/N=C/Cl |
| InChI | InChI=1S/C7H8ClN/c1-3-4-5-7(2)9-6-8/h3-6H,1-2H2/b5-4-,9-6+ |
| InChIKey | CGCMKDBWBMVGIL-KMOPYBJPSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|