C30H28FN5O2 — CID 163736829
(5aR,6R,9aR)-3-(2-fluorophenyl)-6,8,9a-trimethyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9-tetrahydro-4H-benzo[g]indazole-8-carbonitrile (PubChem CID 163736829) has the molecular formula C30H28FN5O2 and a molecular weight of 509.59 g/mol. Its IUPAC name is (5aR,6R,9aR)-3-(2-fluorophenyl)-6,8,9a-trimethyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9-tetrahydro-4H-benzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aR)-3-(2-fluorophenyl)-6,8,9a-trimethyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9-tetrahydro-4H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 163736829 |
| Molecular Formula | C30H28FN5O2 |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (5aR,6R,9aR)-3-(2-fluorophenyl)-6,8,9a-trimethyl-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-7-oxo-5,5a,6,9-tetrahydro-4H-benzo[g]indazole-8-carbonitrile |
| SMILES | Cc1nc(-c2ccc(-n3nc(-c4ccccc4F)c4c3[C@]3(C)CC(C)(C#N)C(=O)[C@H](C)[C@H]3CC4)cc2)no1 |
| InChI | InChI=1S/C30H28FN5O2/c1-17-23-14-13-22-25(21-7-5-6-8-24(21)31)34-36(26(22)30(23,4)15-29(3,16-32)27(17)37)20-11-9-19(10-12-20)28-33-18(2)38-35-28/h5-12,17,23H,13-15H2,1-4H3/t17-,23-,29?,30-/m1/s1 |
| InChIKey | LEJBJKHERFKRGL-RWSLAPQLSA-N |
| XLogP | 6.00 |
| TPSA | 97.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |