C12H25NO — CID 163740536
(2S)-3-(2,2,3,3-tetramethylbutoxy)but-3-en-2-amine (PubChem CID 163740536) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (2S)-3-(2,2,3,3-tetramethylbutoxy)but-3-en-2-amine.
| Compound Name | (2S)-3-(2,2,3,3-tetramethylbutoxy)but-3-en-2-amine |
|---|---|
| PubChem CID | 163740536 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (2S)-3-(2,2,3,3-tetramethylbutoxy)but-3-en-2-amine |
| SMILES | C=C(OCC(C)(C)C(C)(C)C)[C@H](C)N |
| InChI | InChI=1S/C12H25NO/c1-9(13)10(2)14-8-12(6,7)11(3,4)5/h9H,2,8,13H2,1,3-7H3/t9-/m0/s1 |
| InChIKey | APWYWXUSXGMBBI-VIFPVBQESA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|