C14H29NO — CID 163740539
(3S)-4-methyl-2-(2,2,3,3-tetramethylbutoxy)pent-1-en-3-amine (PubChem CID 163740539) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is (3S)-4-methyl-2-(2,2,3,3-tetramethylbutoxy)pent-1-en-3-amine.
| Compound Name | (3S)-4-methyl-2-(2,2,3,3-tetramethylbutoxy)pent-1-en-3-amine |
|---|---|
| PubChem CID | 163740539 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | (3S)-4-methyl-2-(2,2,3,3-tetramethylbutoxy)pent-1-en-3-amine |
| SMILES | C=C(OCC(C)(C)C(C)(C)C)[C@@H](N)C(C)C |
| InChI | InChI=1S/C14H29NO/c1-10(2)12(15)11(3)16-9-14(7,8)13(4,5)6/h10,12H,3,9,15H2,1-2,4-8H3/t12-/m0/s1 |
| InChIKey | VBVZQFAKWXKKPP-LBPRGKRZSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|