C9H14Cl2O — CID 163741498
(2R)-1,1-dichloro-1-[(1R)-cyclohex-2-en-1-yl]propan-2-ol (PubChem CID 163741498) has the molecular formula C9H14Cl2O and a molecular weight of 209.12 g/mol. Its IUPAC name is (2R)-1,1-dichloro-1-[(1R)-cyclohex-2-en-1-yl]propan-2-ol.
| Compound Name | (2R)-1,1-dichloro-1-[(1R)-cyclohex-2-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 163741498 |
| Molecular Formula | C9H14Cl2O |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | (2R)-1,1-dichloro-1-[(1R)-cyclohex-2-en-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)C(Cl)(Cl)[C@H]1C=CCCC1 |
| InChI | InChI=1S/C9H14Cl2O/c1-7(12)9(10,11)8-5-3-2-4-6-8/h3,5,7-8,12H,2,4,6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | LIDXTZVQIWAZEL-SFYZADRCSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|