C17H21F3N2 — CID 163742238
N-methyl-1-piperidin-4-yl-1-[2-prop-1-en-2-yl-4-(trifluoromethyl)phenyl]methanimine (PubChem CID 163742238) has the molecular formula C17H21F3N2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-methyl-1-piperidin-4-yl-1-[2-prop-1-en-2-yl-4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-methyl-1-piperidin-4-yl-1-[2-prop-1-en-2-yl-4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 163742238 |
| Molecular Formula | C17H21F3N2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-methyl-1-piperidin-4-yl-1-[2-prop-1-en-2-yl-4-(trifluoromethyl)phenyl]methanimine |
| SMILES | C=C(C)c1cc(C(F)(F)F)ccc1/C(=N/C)C1CCNCC1 |
| InChI | InChI=1S/C17H21F3N2/c1-11(2)15-10-13(17(18,19)20)4-5-14(15)16(21-3)12-6-8-22-9-7-12/h4-5,10,12,22H,1,6-9H2,2-3H3/b21-16+ |
| InChIKey | LITONAOZVCVLMZ-LTGZKZEYSA-N |
| XLogP | 4.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|