C33H37F3N2 — CID 146259807
N-[4-(1-phenyl-1-piperidin-4-ylethyl)-2-prop-1-en-2-ylphenyl]-4-[4-(trifluoromethyl)phenyl]butan-2-imine (PubChem CID 146259807) has the molecular formula C33H37F3N2 and a molecular weight of 518.67 g/mol. Its IUPAC name is N-[4-(1-phenyl-1-piperidin-4-ylethyl)-2-prop-1-en-2-ylphenyl]-4-[4-(trifluoromethyl)phenyl]butan-2-imine.
| Compound Name | N-[4-(1-phenyl-1-piperidin-4-ylethyl)-2-prop-1-en-2-ylphenyl]-4-[4-(trifluoromethyl)phenyl]butan-2-imine |
|---|---|
| PubChem CID | 146259807 |
| Molecular Formula | C33H37F3N2 |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | N-[4-(1-phenyl-1-piperidin-4-ylethyl)-2-prop-1-en-2-ylphenyl]-4-[4-(trifluoromethyl)phenyl]butan-2-imine |
| SMILES | C=C(C)c1cc(C(C)(c2ccccc2)C2CCNCC2)ccc1/N=C(\C)CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H37F3N2/c1-23(2)30-22-29(32(4,26-8-6-5-7-9-26)27-18-20-37-21-19-27)16-17-31(30)38-24(3)10-11-25-12-14-28(15-13-25)33(34,35)36/h5-9,12-17,22,27,37H,1,10-11,18-21H2,2-4H3/b38-24+ |
| InChIKey | AUQDQFATJBJDGO-RQXXSLPSSA-N |
| XLogP | 8.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|