C60H75ClN2O2 — CID 157311836
1-tert-butyl-4-(2-chloroethyl)benzene;[1-[2-(4-tert-butylphenyl)ethyl]piperidin-4-yl]-diphenylmethanol;diphenyl(piperidin-4-yl)methanol (PubChem CID 157311836) has the molecular formula C60H75ClN2O2 and a molecular weight of 891.72 g/mol. Its IUPAC name is 1-tert-butyl-4-(2-chloroethyl)benzene;[1-[2-(4-tert-butylphenyl)ethyl]piperidin-4-yl]-diphenylmethanol;diphenyl(piperidin-4-yl)methanol.
| Compound Name | 1-tert-butyl-4-(2-chloroethyl)benzene;[1-[2-(4-tert-butylphenyl)ethyl]piperidin-4-yl]-diphenylmethanol;diphenyl(piperidin-4-yl)methanol |
|---|---|
| PubChem CID | 157311836 |
| Molecular Formula | C60H75ClN2O2 |
| Molecular Weight | 891.72 g/mol |
| Exact Mass | 890.55 |
| IUPAC Name | 1-tert-butyl-4-(2-chloroethyl)benzene;[1-[2-(4-tert-butylphenyl)ethyl]piperidin-4-yl]-diphenylmethanol;diphenyl(piperidin-4-yl)methanol |
| SMILES | CC(C)(C)c1ccc(CCCl)cc1.CC(C)(C)c1ccc(CCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1.OC(c1ccccc1)(c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C30H37NO.C18H21NO.C12H17Cl/c1-29(2,3)25-16-14-24(15-17-25)18-21-31-22-19-28(20-23-31)30(32,26-10-6-4-7-11-26)27-12-8-5-9-13-27;20-18(15-7-3-1-4-8-15,16-9-5-2-6-10-16)17-11-13-19-14-12-17;1-12(2,3)11-6-4-10(5-7-11)8-9-13/h4-17,28,32H,18-23H2,1-3H3;1-10,17,19-20H,11-14H2;4-7H,8-9H2,1-3H3 |
| InChIKey | BDCZFLGVSXGZHV-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.72 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|