C22H27N — CID 163743423
3,6-ditert-butyl-N-methylfluoren-9-imine (PubChem CID 163743423) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is 3,6-ditert-butyl-N-methylfluoren-9-imine.
| Compound Name | 3,6-ditert-butyl-N-methylfluoren-9-imine |
|---|---|
| PubChem CID | 163743423 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 3,6-ditert-butyl-N-methylfluoren-9-imine |
| SMILES | CN=C1c2ccc(C(C)(C)C)cc2-c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C22H27N/c1-21(2,3)14-8-10-16-18(12-14)19-13-15(22(4,5)6)9-11-17(19)20(16)23-7/h8-13H,1-7H3 |
| InChIKey | LJSYCMOBPPHVMV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|