C22H30O4 — CID 163744531
bis(cyclohex-2-en-1-ylmethyl) cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 163744531) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is bis(cyclohex-2-en-1-ylmethyl) cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | bis(cyclohex-2-en-1-ylmethyl) cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163744531 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | bis(cyclohex-2-en-1-ylmethyl) cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | O=C(OCC1C=CCCC1)C1CC=CCC1C(=O)OCC1C=CCCC1 |
| InChI | InChI=1S/C22H30O4/c23-21(25-15-17-9-3-1-4-10-17)19-13-7-8-14-20(19)22(24)26-16-18-11-5-2-6-12-18/h3,5,7-9,11,17-20H,1-2,4,6,10,12-16H2 |
| InChIKey | LKRILPLGDOZVQX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|