C30H33NO4 — CID 163746186
ethyl 2-[4-[4-[2-(1-aminoethylidene)-3-hydroxy-6-phenylhexanoyl]phenyl]phenyl]acetate (PubChem CID 163746186) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 2-[4-[4-[2-(1-aminoethylidene)-3-hydroxy-6-phenylhexanoyl]phenyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[4-[2-(1-aminoethylidene)-3-hydroxy-6-phenylhexanoyl]phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 163746186 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | ethyl 2-[4-[4-[2-(1-aminoethylidene)-3-hydroxy-6-phenylhexanoyl]phenyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-c2ccc(C(=O)C(=C(C)N)C(O)CCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H33NO4/c1-3-35-28(33)20-23-12-14-24(15-13-23)25-16-18-26(19-17-25)30(34)29(21(2)31)27(32)11-7-10-22-8-5-4-6-9-22/h4-6,8-9,12-19,27,32H,3,7,10-11,20,31H2,1-2H3 |
| InChIKey | SSPGKXXZVYIJHA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|