C16H24F2NO+ — CID 163746664
3-(3,5-difluorohepta-1,3,5-trien-2-yl)-1-(oxan-4-yl)pyrrolidin-1-ium (PubChem CID 163746664) has the molecular formula C16H24F2NO+ and a molecular weight of 284.37 g/mol. Its IUPAC name is 3-(3,5-difluorohepta-1,3,5-trien-2-yl)-1-(oxan-4-yl)pyrrolidin-1-ium.
| Compound Name | 3-(3,5-difluorohepta-1,3,5-trien-2-yl)-1-(oxan-4-yl)pyrrolidin-1-ium |
|---|---|
| PubChem CID | 163746664 |
| Molecular Formula | C16H24F2NO+ |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 3-(3,5-difluorohepta-1,3,5-trien-2-yl)-1-(oxan-4-yl)pyrrolidin-1-ium |
| SMILES | C=C(C(F)=CC(F)=CC)C1CC[NH+](C2CCOCC2)C1 |
| InChI | InChI=1S/C16H23F2NO/c1-3-14(17)10-16(18)12(2)13-4-7-19(11-13)15-5-8-20-9-6-15/h3,10,13,15H,2,4-9,11H2,1H3/p+1 |
| InChIKey | LMLUAVYSHVACSL-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|