C18H28CrNO- — CID 177146483
chromium;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine;4-methyloxane (PubChem CID 177146483) has the molecular formula C18H28CrNO- and a molecular weight of 326.42 g/mol. Its IUPAC name is chromium;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine;4-methyloxane.
| Compound Name | chromium;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine;4-methyloxane |
|---|---|
| PubChem CID | 177146483 |
| Molecular Formula | C18H28CrNO- |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | chromium;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine;4-methyloxane |
| SMILES | CC1CCOCC1.Cc1[c-]c([C@H]2NCC[C@H]2C)ccc1.[Cr] |
| InChI | InChI=1S/C12H16N.C6H12O.Cr/c1-9-4-3-5-11(8-9)12-10(2)6-7-13-12;1-6-2-4-7-5-3-6;/h3-5,10,12-13H,6-7H2,1-2H3;6H,2-5H2,1H3;/q-1;;/t10-,12+;;/m1../s1 |
| InChIKey | LKGUBYWRGUPQLH-BOTBFRDUSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|