C18H30CrNO- — CID 177146358
chromium;hexan-3-ol;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine (PubChem CID 177146358) has the molecular formula C18H30CrNO- and a molecular weight of 328.44 g/mol. Its IUPAC name is chromium;hexan-3-ol;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine.
| Compound Name | chromium;hexan-3-ol;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 177146358 |
| Molecular Formula | C18H30CrNO- |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | chromium;hexan-3-ol;(2S,3R)-3-methyl-2-(3-methylbenzene-2-id-1-yl)pyrrolidine |
| SMILES | CCCC(O)CC.Cc1[c-]c([C@H]2NCC[C@H]2C)ccc1.[Cr] |
| InChI | InChI=1S/C12H16N.C6H14O.Cr/c1-9-4-3-5-11(8-9)12-10(2)6-7-13-12;1-3-5-6(7)4-2;/h3-5,10,12-13H,6-7H2,1-2H3;6-7H,3-5H2,1-2H3;/q-1;;/t10-,12+;;/m1../s1 |
| InChIKey | COOHTCJMTXBHGJ-BOTBFRDUSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|