About chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol
chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol (PubChem CID 177146390) has the molecular formula C11H14CrNO-
and a molecular weight of 228.23 g/mol. Its IUPAC name is chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol |
| PubChem CID | 177146390 |
| Molecular Formula | C11H14CrNO- |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol |
| SMILES | Cc1[c-]c(C2NCCC2O)ccc1.[Cr] |
| InChI | InChI=1S/C11H14NO.Cr/c1-8-3-2-4-9(7-8)11-10(13)5-6-12-11;/h2-4,10-13H,5-6H2,1H3;/q-1; |
| InChIKey | WUXFUVOECPXTMG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol?
The IUPAC name of chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol (CID 177146390) is chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol.
What is the SMILES notation for chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol?
The canonical SMILES for chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol is Cc1[c-]c(C2NCCC2O)ccc1.[Cr].
What is the InChIKey of chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol?
The InChIKey is WUXFUVOECPXTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO.Cr/c1-8-3-2-4-9(7-8)11-10(13)5-6-12-11;/h2-4,10-13H,5-6H2,1H3;/q-1;.
What are the key properties of chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol?
chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol has a molecular weight of 228.23 g/mol, XLogP of 1.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;2-(3-methylbenzene-2-id-1-yl)pyrrolidin-3-ol is sourced from PubChem (CID 177146390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).