C15H28N2O — CID 143163545
(Z,2S,3S,5Z)-2-amino-5-ethylidene-1-pyrrolidin-1-ylnon-6-en-3-ol (PubChem CID 143163545) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (Z,2S,3S,5Z)-2-amino-5-ethylidene-1-pyrrolidin-1-ylnon-6-en-3-ol.
| Compound Name | (Z,2S,3S,5Z)-2-amino-5-ethylidene-1-pyrrolidin-1-ylnon-6-en-3-ol |
|---|---|
| PubChem CID | 143163545 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (Z,2S,3S,5Z)-2-amino-5-ethylidene-1-pyrrolidin-1-ylnon-6-en-3-ol |
| SMILES | C/C=C(\C=C/CC)C[C@H](O)[C@@H](N)CN1CCCC1 |
| InChI | InChI=1S/C15H28N2O/c1-3-5-8-13(4-2)11-15(18)14(16)12-17-9-6-7-10-17/h4-5,8,14-15,18H,3,6-7,9-12,16H2,1-2H3/b8-5-,13-4+/t14-,15-/m0/s1 |
| InChIKey | DPPGMEVAJOOOFD-UTMYAMFTSA-N |
| XLogP | 2.07 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|