C16H35NO — CID 143342945
ethane;4-methyl-2-(methylamino)-3-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol (PubChem CID 143342945) has the molecular formula C16H35NO and a molecular weight of 257.46 g/mol. Its IUPAC name is ethane;4-methyl-2-(methylamino)-3-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol.
| Compound Name | ethane;4-methyl-2-(methylamino)-3-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 143342945 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | ethane;4-methyl-2-(methylamino)-3-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol |
| SMILES | C/C=C\C1=C(C)CC(O)C1NC.CC.CC.CC |
| InChI | InChI=1S/C10H17NO.3C2H6/c1-4-5-8-7(2)6-9(12)10(8)11-3;3*1-2/h4-5,9-12H,6H2,1-3H3;3*1-2H3/b5-4-;;; |
| InChIKey | WNIHYBJDUHOMII-OAWHIZORSA-N |
| XLogP | 4.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |