C21H37NO — CID 143596732
1-[5-(4-pentylcyclohepta-1,3,5-trien-1-yl)pentan-2-ylamino]butan-2-ol (PubChem CID 143596732) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is 1-[5-(4-pentylcyclohepta-1,3,5-trien-1-yl)pentan-2-ylamino]butan-2-ol.
| Compound Name | 1-[5-(4-pentylcyclohepta-1,3,5-trien-1-yl)pentan-2-ylamino]butan-2-ol |
|---|---|
| PubChem CID | 143596732 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | 1-[5-(4-pentylcyclohepta-1,3,5-trien-1-yl)pentan-2-ylamino]butan-2-ol |
| SMILES | CCCCCC1=CC=C(CCCC(C)NCC(O)CC)CC=C1 |
| InChI | InChI=1S/C21H37NO/c1-4-6-7-11-19-13-9-14-20(16-15-19)12-8-10-18(3)22-17-21(23)5-2/h9,13,15-16,18,21-23H,4-8,10-12,14,17H2,1-3H3 |
| InChIKey | YFKJZBAKKAAAMT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|