C35H43N3O2 — CID 163746816
(2R,3S,5R)-2-[4-(cyclopentylamino)phenyl]-1-(2,6-dimethylbenzoyl)-N-(3,4-dimethylphenyl)-5-methylpiperidine-3-carboxamide (PubChem CID 163746816) has the molecular formula C35H43N3O2 and a molecular weight of 537.75 g/mol. Its IUPAC name is (2R,3S,5R)-2-[4-(cyclopentylamino)phenyl]-1-(2,6-dimethylbenzoyl)-N-(3,4-dimethylphenyl)-5-methylpiperidine-3-carboxamide.
| Compound Name | (2R,3S,5R)-2-[4-(cyclopentylamino)phenyl]-1-(2,6-dimethylbenzoyl)-N-(3,4-dimethylphenyl)-5-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 163746816 |
| Molecular Formula | C35H43N3O2 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.34 |
| IUPAC Name | (2R,3S,5R)-2-[4-(cyclopentylamino)phenyl]-1-(2,6-dimethylbenzoyl)-N-(3,4-dimethylphenyl)-5-methylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2C[C@@H](C)CN(C(=O)c3c(C)cccc3C)C2c2ccc(NC3CCCC3)cc2)cc1C |
| InChI | InChI=1S/C35H43N3O2/c1-22-19-31(34(39)37-30-16-13-23(2)26(5)20-30)33(27-14-17-29(18-15-27)36-28-11-6-7-12-28)38(21-22)35(40)32-24(3)9-8-10-25(32)4/h8-10,13-18,20,22,28,31,33,36H,6-7,11-12,19,21H2,1-5H3,(H,37,39)/t22-,31+,33?/m1/s1 |
| InChIKey | VQACTUFNJZZBNR-ZWPPESHRSA-N |
| XLogP | 7.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |