C44H28N4U — CID 163749746
N-phenyl-3-phenyl-N-[4-(6-phenylindolo[3,2-b]quinoxalin-9-yl)phenyl]benzene-2-id-1-amine;uranium(2+) (PubChem CID 163749746) has the molecular formula C44H28N4U and a molecular weight of 850.77 g/mol. Its IUPAC name is N-phenyl-3-phenyl-N-[4-(6-phenylindolo[3,2-b]quinoxalin-9-yl)phenyl]benzene-2-id-1-amine;uranium(2+).
| Compound Name | N-phenyl-3-phenyl-N-[4-(6-phenylindolo[3,2-b]quinoxalin-9-yl)phenyl]benzene-2-id-1-amine;uranium(2+) |
|---|---|
| PubChem CID | 163749746 |
| Molecular Formula | C44H28N4U |
| Molecular Weight | 850.77 g/mol |
| Exact Mass | 850.28 |
| IUPAC Name | N-phenyl-3-phenyl-N-[4-(6-phenylindolo[3,2-b]quinoxalin-9-yl)phenyl]benzene-2-id-1-amine;uranium(2+) |
| SMILES | [U+2].[c-]1ccccc1-c1[c-]c(N(c2ccccc2)c2ccc(-c3ccc4c(c3)c3nc5ccccc5nc3n4-c3ccccc3)cc2)ccc1 |
| InChI | InChI=1S/C44H28N4.U/c1-4-13-31(14-5-1)33-15-12-20-38(29-33)47(35-16-6-2-7-17-35)37-26-23-32(24-27-37)34-25-28-42-39(30-34)43-44(48(42)36-18-8-3-9-19-36)46-41-22-11-10-21-40(41)45-43;/h1-13,15-28,30H;/q-2;+2 |
| InChIKey | NVCCKSRMERUCQF-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.77 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|