C50H32N2OU — CID 163782435
3-phenyl-N-[3-(6-phenyl-[1]benzofuro[2,3-b]indol-3-yl)phenyl]-N-(4-phenylphenyl)benzene-2-id-1-amine;uranium(2+) (PubChem CID 163782435) has the molecular formula C50H32N2OU and a molecular weight of 914.85 g/mol. Its IUPAC name is 3-phenyl-N-[3-(6-phenyl-[1]benzofuro[2,3-b]indol-3-yl)phenyl]-N-(4-phenylphenyl)benzene-2-id-1-amine;uranium(2+).
| Compound Name | 3-phenyl-N-[3-(6-phenyl-[1]benzofuro[2,3-b]indol-3-yl)phenyl]-N-(4-phenylphenyl)benzene-2-id-1-amine;uranium(2+) |
|---|---|
| PubChem CID | 163782435 |
| Molecular Formula | C50H32N2OU |
| Molecular Weight | 914.85 g/mol |
| Exact Mass | 914.30 |
| IUPAC Name | 3-phenyl-N-[3-(6-phenyl-[1]benzofuro[2,3-b]indol-3-yl)phenyl]-N-(4-phenylphenyl)benzene-2-id-1-amine;uranium(2+) |
| SMILES | [U+2].[c-]1ccccc1-c1[c-]c(N(c2ccc(-c3ccccc3)cc2)c2cccc(-c3ccc4c(c3)oc3c4c4ccccc4n3-c3ccccc3)c2)ccc1 |
| InChI | InChI=1S/C50H32N2O.U/c1-4-14-35(15-5-1)37-26-29-42(30-27-37)51(43-22-12-18-38(32-43)36-16-6-2-7-17-36)44-23-13-19-39(33-44)40-28-31-46-48(34-40)53-50-49(46)45-24-10-11-25-47(45)52(50)41-20-8-3-9-21-41;/h1-16,18-31,33-34H;/q-2;+2 |
| InChIKey | CRXOIZAUZQHSBQ-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 21.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.85 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|