C28H22F5IN2O4S — CID 163750864
[3-[4-[4-[5-(aminomethyl)-2-[difluoro(iodo)methyl]phenoxy]phenyl]sulfonylphenoxy]-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 163750864) has the molecular formula C28H22F5IN2O4S and a molecular weight of 704.46 g/mol. Its IUPAC name is [3-[4-[4-[5-(aminomethyl)-2-[difluoro(iodo)methyl]phenoxy]phenyl]sulfonylphenoxy]-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | [3-[4-[4-[5-(aminomethyl)-2-[difluoro(iodo)methyl]phenoxy]phenyl]sulfonylphenoxy]-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 163750864 |
| Molecular Formula | C28H22F5IN2O4S |
| Molecular Weight | 704.46 g/mol |
| Exact Mass | 704.03 |
| IUPAC Name | [3-[4-[4-[5-(aminomethyl)-2-[difluoro(iodo)methyl]phenoxy]phenyl]sulfonylphenoxy]-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | NCc1ccc(C(F)(F)F)c(Oc2ccc(S(=O)(=O)c3ccc(Oc4cc(CN)ccc4C(F)(F)I)cc3)cc2)c1 |
| InChI | InChI=1S/C28H22F5IN2O4S/c29-27(30,31)23-11-1-17(15-35)13-25(23)39-19-3-7-21(8-4-19)41(37,38)22-9-5-20(6-10-22)40-26-14-18(16-36)2-12-24(26)28(32,33)34/h1-14H,15-16,35-36H2 |
| InChIKey | LPWHWBLGHRWPKH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.46 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|