C13H12F3N3O — CID 174335229
[3-(pyrimidin-5-ylmethoxy)-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 174335229) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is [3-(pyrimidin-5-ylmethoxy)-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | [3-(pyrimidin-5-ylmethoxy)-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 174335229 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [3-(pyrimidin-5-ylmethoxy)-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | NCc1ccc(C(F)(F)F)c(OCc2cncnc2)c1 |
| InChI | InChI=1S/C13H12F3N3O/c14-13(15,16)11-2-1-9(4-17)3-12(11)20-7-10-5-18-8-19-6-10/h1-3,5-6,8H,4,7,17H2 |
| InChIKey | ILQWBCOOENUDFC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |