C21H24F3N3O3 — CID 174333432
tert-butyl N-[4-[[5-(aminomethyl)-2-(trifluoromethyl)phenoxy]methyl]-2-methanimidoylphenyl]carbamate (PubChem CID 174333432) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-(aminomethyl)-2-(trifluoromethyl)phenoxy]methyl]-2-methanimidoylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-(aminomethyl)-2-(trifluoromethyl)phenoxy]methyl]-2-methanimidoylphenyl]carbamate |
|---|---|
| PubChem CID | 174333432 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | tert-butyl N-[4-[[5-(aminomethyl)-2-(trifluoromethyl)phenoxy]methyl]-2-methanimidoylphenyl]carbamate |
| SMILES | [H]/N=C/c1cc(COc2cc(CN)ccc2C(F)(F)F)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H24F3N3O3/c1-20(2,3)30-19(28)27-17-7-5-14(8-15(17)11-26)12-29-18-9-13(10-25)4-6-16(18)21(22,23)24/h4-9,11,26H,10,12,25H2,1-3H3,(H,27,28)/b26-11+ |
| InChIKey | RHLMAENJYSGFPL-KBKYJPHKSA-N |
| XLogP | 5.09 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|