C49H29N3S2 — CID 163752158
2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine (PubChem CID 163752158) has the molecular formula C49H29N3S2 and a molecular weight of 723.93 g/mol. Its IUPAC name is 2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163752158 |
| Molecular Formula | C49H29N3S2 |
| Molecular Weight | 723.93 g/mol |
| Exact Mass | 723.18 |
| IUPAC Name | 2-[3,5-di(dibenzothiophen-3-yl)phenyl]-4-naphthalen-1-yl-6-phenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3cc(-c4ccc5c(c4)sc4ccccc45)cc(-c4ccc5c(c4)sc4ccccc45)c3)nc(-c3cccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C49H29N3S2/c1-2-12-31(13-3-1)47-50-48(52-49(51-47)42-18-10-14-30-11-4-5-15-37(30)42)36-26-34(32-21-23-40-38-16-6-8-19-43(38)53-45(40)28-32)25-35(27-36)33-22-24-41-39-17-7-9-20-44(39)54-46(41)29-33/h1-29H |
| InChIKey | LQXNZDUHXMPOJA-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.93 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |