C19H27ClN4O4S — CID 163754005
[[(1S)-1-[5-[(4-tert-butylphenyl)methylcarbamoyl]-4-chloro-1-methylpyrazol-3-yl]ethyl]amino] methanesulfonate (PubChem CID 163754005) has the molecular formula C19H27ClN4O4S and a molecular weight of 442.97 g/mol. Its IUPAC name is [[(1S)-1-[5-[(4-tert-butylphenyl)methylcarbamoyl]-4-chloro-1-methylpyrazol-3-yl]ethyl]amino] methanesulfonate.
| Compound Name | [[(1S)-1-[5-[(4-tert-butylphenyl)methylcarbamoyl]-4-chloro-1-methylpyrazol-3-yl]ethyl]amino] methanesulfonate |
|---|---|
| PubChem CID | 163754005 |
| Molecular Formula | C19H27ClN4O4S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [[(1S)-1-[5-[(4-tert-butylphenyl)methylcarbamoyl]-4-chloro-1-methylpyrazol-3-yl]ethyl]amino] methanesulfonate |
| SMILES | C[C@H](NOS(C)(=O)=O)c1nn(C)c(C(=O)NCc2ccc(C(C)(C)C)cc2)c1Cl |
| InChI | InChI=1S/C19H27ClN4O4S/c1-12(23-28-29(6,26)27)16-15(20)17(24(5)22-16)18(25)21-11-13-7-9-14(10-8-13)19(2,3)4/h7-10,12,23H,11H2,1-6H3,(H,21,25)/t12-/m0/s1 |
| InChIKey | LSLTWLDFZNYLEO-LBPRGKRZSA-N |
| XLogP | 2.84 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|