About carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+)
carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) (PubChem CID 163755455) has the molecular formula C5H8NTm
and a molecular weight of 251.06 g/mol. Its IUPAC name is carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+).
Molecular Properties
| Compound Name | carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) |
| PubChem CID | 163755455 |
| Molecular Formula | C5H8NTm |
| Molecular Weight | 251.06 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) |
| SMILES | [CH3-].[H]/[C-]=N/C(C)=[C-]/[H].[Tm+3] |
| InChI | InChI=1S/C4H5N.CH3.Tm/c1-4(2)5-3;;/h1,3H,2H3;1H3;/q-2;-1;+3 |
| InChIKey | AEHOOEGLBYESLQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.06 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+)?
The IUPAC name of carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) (CID 163755455) is carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+).
What is the SMILES notation for carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+)?
The canonical SMILES for carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) is [CH3-].[H]/[C-]=N/C(C)=[C-]/[H].[Tm+3].
What is the InChIKey of carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+)?
The InChIKey is AEHOOEGLBYESLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N.CH3.Tm/c1-4(2)5-3;;/h1,3H,2H3;1H3;/q-2;-1;+3.
What are the key properties of carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+)?
carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) has a molecular weight of 251.06 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;N-prop-1-en-2-ylmethanimine;thulium(3+) is sourced from PubChem (CID 163755455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).