C11H25N5S — CID 163758430
1-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-3-prop-2-enylthiourea (PubChem CID 163758430) has the molecular formula C11H25N5S and a molecular weight of 259.42 g/mol. Its IUPAC name is 1-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 163758430 |
| Molecular Formula | C11H25N5S |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 1-[1,3-bis(methylamino)-2-(methylaminomethyl)propan-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NC(CNC)(CNC)CNC |
| InChI | InChI=1S/C11H25N5S/c1-5-6-15-10(17)16-11(7-12-2,8-13-3)9-14-4/h5,12-14H,1,6-9H2,2-4H3,(H2,15,16,17) |
| InChIKey | LWBYSCGVLNBQTL-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|