C16H21O4+ — CID 163758619
[(Z)-4-(4-tert-butylphenyl)-1-ethoxy-1,4-dioxobut-2-en-2-yl]oxidanium (PubChem CID 163758619) has the molecular formula C16H21O4+ and a molecular weight of 277.34 g/mol. Its IUPAC name is [(Z)-4-(4-tert-butylphenyl)-1-ethoxy-1,4-dioxobut-2-en-2-yl]oxidanium.
| Compound Name | [(Z)-4-(4-tert-butylphenyl)-1-ethoxy-1,4-dioxobut-2-en-2-yl]oxidanium |
|---|---|
| PubChem CID | 163758619 |
| Molecular Formula | C16H21O4+ |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [(Z)-4-(4-tert-butylphenyl)-1-ethoxy-1,4-dioxobut-2-en-2-yl]oxidanium |
| SMILES | CCOC(=O)/C([OH2+])=C/C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H20O4/c1-5-20-15(19)14(18)10-13(17)11-6-8-12(9-7-11)16(2,3)4/h6-10,18H,5H2,1-4H3/p+1/b14-10- |
| InChIKey | LWFSUQJKUZJKID-UVTDQMKNSA-O |
| XLogP | 2.34 |
| TPSA | 66.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|