C23H16Cl2F3N3O2 — CID 163759003
4-[2-(5-chloro-2,4-difluorophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)-2,3-dihydroquinoxaline-1-carboxamide (PubChem CID 163759003) has the molecular formula C23H16Cl2F3N3O2 and a molecular weight of 494.30 g/mol. Its IUPAC name is 4-[2-(5-chloro-2,4-difluorophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)-2,3-dihydroquinoxaline-1-carboxamide.
| Compound Name | 4-[2-(5-chloro-2,4-difluorophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)-2,3-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 163759003 |
| Molecular Formula | C23H16Cl2F3N3O2 |
| Molecular Weight | 494.30 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 4-[2-(5-chloro-2,4-difluorophenyl)acetyl]-N-(3-chloro-4-fluorophenyl)-2,3-dihydroquinoxaline-1-carboxamide |
| SMILES | O=C(Cc1cc(Cl)c(F)cc1F)N1CCN(C(=O)Nc2ccc(F)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C23H16Cl2F3N3O2/c24-15-9-13(18(27)12-19(15)28)10-22(32)30-7-8-31(21-4-2-1-3-20(21)30)23(33)29-14-5-6-17(26)16(25)11-14/h1-6,9,11-12H,7-8,10H2,(H,29,33) |
| InChIKey | LWNYGHYQRDKWED-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.30 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|