C15H22N2O3S — CID 163760094
1-(2-methylpropyl)-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)urea (PubChem CID 163760094) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)urea.
| Compound Name | 1-(2-methylpropyl)-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)urea |
|---|---|
| PubChem CID | 163760094 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-(2-methylpropyl)-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)urea |
| SMILES | CC(C)CNC(=O)NS(=O)(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H22N2O3S/c1-11(2)10-16-15(18)17-21(19,20)14-8-7-12-5-3-4-6-13(12)9-14/h7-9,11H,3-6,10H2,1-2H3,(H2,16,17,18) |
| InChIKey | LXLUTMFWSPJANZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |