C19H19ClN4O5 — CID 163760716
N-[2-[2-chloro-4-(dihydroxyamino)anilino]ethyl]-3-(2-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 163760716) has the molecular formula C19H19ClN4O5 and a molecular weight of 418.84 g/mol. Its IUPAC name is N-[2-[2-chloro-4-(dihydroxyamino)anilino]ethyl]-3-(2-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-[2-chloro-4-(dihydroxyamino)anilino]ethyl]-3-(2-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 163760716 |
| Molecular Formula | C19H19ClN4O5 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N-[2-[2-chloro-4-(dihydroxyamino)anilino]ethyl]-3-(2-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2O)c1C(=O)NCCNc1ccc(N(O)O)cc1Cl |
| InChI | InChI=1S/C19H19ClN4O5/c1-11-17(18(23-29-11)13-4-2-3-5-16(13)25)19(26)22-9-8-21-15-7-6-12(24(27)28)10-14(15)20/h2-7,10,21,25,27-28H,8-9H2,1H3,(H,22,26) |
| InChIKey | LXYFEYVIBRKRAV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|