C30H31ClN6O6 — CID 163649500
N-[2-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitroanilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 163649500) has the molecular formula C30H31ClN6O6 and a molecular weight of 607.07 g/mol. Its IUPAC name is N-[2-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitroanilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitroanilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 163649500 |
| Molecular Formula | C30H31ClN6O6 |
| Molecular Weight | 607.07 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | N-[2-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitroanilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | COc1ccccc1-c1noc(C)c1C(=O)NCCNc1cc(NC(=O)c2ccc(CN(C)C)cc2)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C30H31ClN6O6/c1-18-27(28(35-43-18)21-7-5-6-8-26(21)42-4)30(39)33-14-13-32-23-16-24(25(37(40)41)15-22(23)31)34-29(38)20-11-9-19(10-12-20)17-36(2)3/h5-12,15-16,32H,13-14,17H2,1-4H3,(H,33,39)(H,34,38) |
| InChIKey | ILARLWRTESREQI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 151.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.07 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|