C31H30ClFN6O6 — CID 66692353
N-[4-chloro-5-[4-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)-3-fluorobenzamide (PubChem CID 66692353) has the molecular formula C31H30ClFN6O6 and a molecular weight of 637.07 g/mol. Its IUPAC name is N-[4-chloro-5-[4-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)-3-fluorobenzamide.
| Compound Name | N-[4-chloro-5-[4-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)-3-fluorobenzamide |
|---|---|
| PubChem CID | 66692353 |
| Molecular Formula | C31H30ClFN6O6 |
| Molecular Weight | 637.07 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | N-[4-chloro-5-[4-[3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)-3-fluorobenzamide |
| SMILES | COc1ccccc1-c1noc(C)c1C(=O)N1CCN(c2cc(NC(=O)c3ccc(N(C)C)c(F)c3)c([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C31H30ClFN6O6/c1-18-28(29(35-45-18)20-7-5-6-8-27(20)44-4)31(41)38-13-11-37(12-14-38)25-17-23(26(39(42)43)16-21(25)32)34-30(40)19-9-10-24(36(2)3)22(33)15-19/h5-10,15-17H,11-14H2,1-4H3,(H,34,40) |
| InChIKey | YPEUPAYVKCYNNT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.07 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|