C32H35ClN6O6 — CID 66695763
N-[4-chloro-5-[4-[3-(2-ethoxycyclohexa-2,4-dien-1-yl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)benzamide (PubChem CID 66695763) has the molecular formula C32H35ClN6O6 and a molecular weight of 635.12 g/mol. Its IUPAC name is N-[4-chloro-5-[4-[3-(2-ethoxycyclohexa-2,4-dien-1-yl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)benzamide.
| Compound Name | N-[4-chloro-5-[4-[3-(2-ethoxycyclohexa-2,4-dien-1-yl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 66695763 |
| Molecular Formula | C32H35ClN6O6 |
| Molecular Weight | 635.12 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | N-[4-chloro-5-[4-[3-(2-ethoxycyclohexa-2,4-dien-1-yl)-5-methyl-1,2-oxazole-4-carbonyl]piperazin-1-yl]-2-nitrophenyl]-4-(dimethylamino)benzamide |
| SMILES | CCOC1=CC=CCC1c1noc(C)c1C(=O)N1CCN(c2cc(NC(=O)c3ccc(N(C)C)cc3)c([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C32H35ClN6O6/c1-5-44-28-9-7-6-8-23(28)30-29(20(2)45-35-30)32(41)38-16-14-37(15-17-38)26-19-25(27(39(42)43)18-24(26)33)34-31(40)21-10-12-22(13-11-21)36(3)4/h6-7,9-13,18-19,23H,5,8,14-17H2,1-4H3,(H,34,40) |
| InChIKey | YHIOUXXWXOHRFY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.12 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|