C25H32ClN5O5 — CID 66691742
tert-butyl 4-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitrophenyl]piperazine-1-carboxylate (PubChem CID 66691742) has the molecular formula C25H32ClN5O5 and a molecular weight of 518.01 g/mol. Its IUPAC name is tert-butyl 4-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitrophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitrophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66691742 |
| Molecular Formula | C25H32ClN5O5 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | tert-butyl 4-[2-chloro-5-[[4-[(dimethylamino)methyl]benzoyl]amino]-4-nitrophenyl]piperazine-1-carboxylate |
| SMILES | CN(C)Cc1ccc(C(=O)Nc2cc(N3CCN(C(=O)OC(C)(C)C)CC3)c(Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H32ClN5O5/c1-25(2,3)36-24(33)30-12-10-29(11-13-30)21-15-20(22(31(34)35)14-19(21)26)27-23(32)18-8-6-17(7-9-18)16-28(4)5/h6-9,14-15H,10-13,16H2,1-5H3,(H,27,32) |
| InChIKey | IDWFGMTWVUCMEW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|