C25H30N4OS — CID 163761328
3-[2-[4-(4-cyano-5-methyl-4-thiophen-3-ylhex-5-enyl)piperazin-1-yl]ethoxy]benzonitrile (PubChem CID 163761328) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is 3-[2-[4-(4-cyano-5-methyl-4-thiophen-3-ylhex-5-enyl)piperazin-1-yl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[4-(4-cyano-5-methyl-4-thiophen-3-ylhex-5-enyl)piperazin-1-yl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 163761328 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3-[2-[4-(4-cyano-5-methyl-4-thiophen-3-ylhex-5-enyl)piperazin-1-yl]ethoxy]benzonitrile |
| SMILES | C=C(C)C(C#N)(CCCN1CCN(CCOc2cccc(C#N)c2)CC1)c1ccsc1 |
| InChI | InChI=1S/C25H30N4OS/c1-21(2)25(20-27,23-7-16-31-19-23)8-4-9-28-10-12-29(13-11-28)14-15-30-24-6-3-5-22(17-24)18-26/h3,5-7,16-17,19H,1,4,8-15H2,2H3 |
| InChIKey | LYLATFXEHDVYGL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|