C15H21N3S — CID 163761459
1-N,1-N,2-trimethyl-1-N'-pyridin-2-yl-1-N'-thiophen-2-ylpropane-1,1-diamine (PubChem CID 163761459) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-N,1-N,2-trimethyl-1-N'-pyridin-2-yl-1-N'-thiophen-2-ylpropane-1,1-diamine.
| Compound Name | 1-N,1-N,2-trimethyl-1-N'-pyridin-2-yl-1-N'-thiophen-2-ylpropane-1,1-diamine |
|---|---|
| PubChem CID | 163761459 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-N,1-N,2-trimethyl-1-N'-pyridin-2-yl-1-N'-thiophen-2-ylpropane-1,1-diamine |
| SMILES | CC(C)C(N(C)C)N(c1ccccn1)c1cccs1 |
| InChI | InChI=1S/C15H21N3S/c1-12(2)15(17(3)4)18(14-9-7-11-19-14)13-8-5-6-10-16-13/h5-12,15H,1-4H3 |
| InChIKey | LYNJVBZQDZJIIF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|