C25H25ClF3NOS — CID 163761809
(2S)-4-benzyl-2-[(S)-(4-chlorocyclohexa-1,5-dien-1-yl)-[2-(trifluoromethyl)phenyl]sulfanylmethyl]morpholine (PubChem CID 163761809) has the molecular formula C25H25ClF3NOS and a molecular weight of 480.00 g/mol. Its IUPAC name is (2S)-4-benzyl-2-[(S)-(4-chlorocyclohexa-1,5-dien-1-yl)-[2-(trifluoromethyl)phenyl]sulfanylmethyl]morpholine.
| Compound Name | (2S)-4-benzyl-2-[(S)-(4-chlorocyclohexa-1,5-dien-1-yl)-[2-(trifluoromethyl)phenyl]sulfanylmethyl]morpholine |
|---|---|
| PubChem CID | 163761809 |
| Molecular Formula | C25H25ClF3NOS |
| Molecular Weight | 480.00 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | (2S)-4-benzyl-2-[(S)-(4-chlorocyclohexa-1,5-dien-1-yl)-[2-(trifluoromethyl)phenyl]sulfanylmethyl]morpholine |
| SMILES | FC(F)(F)c1ccccc1S[C@@H](C1=CCC(Cl)C=C1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C25H25ClF3NOS/c26-20-12-10-19(11-13-20)24(32-23-9-5-4-8-21(23)25(27,28)29)22-17-30(14-15-31-22)16-18-6-2-1-3-7-18/h1-12,20,22,24H,13-17H2/t20?,22-,24-/m0/s1 |
| InChIKey | LYUPMWBXMNZNGK-HEIGWGIGSA-N |
| XLogP | 6.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.00 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|