C64H41NO — CID 163761813
N-[4-(6-phenyldibenzofuran-4-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]phenanthren-9-amine (PubChem CID 163761813) has the molecular formula C64H41NO and a molecular weight of 844.06 g/mol. Its IUPAC name is N-[4-(6-phenyldibenzofuran-4-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]phenanthren-9-amine.
| Compound Name | N-[4-(6-phenyldibenzofuran-4-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]phenanthren-9-amine |
|---|---|
| PubChem CID | 163761813 |
| Molecular Formula | C64H41NO |
| Molecular Weight | 844.06 g/mol |
| Exact Mass | 843.34 |
| IUPAC Name | N-[4-(6-phenyldibenzofuran-4-yl)phenyl]-N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]phenanthren-9-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4c3oc3c(-c5ccccc5)cccc34)cc2)c2cc3ccccc3c3ccccc23)c([2H])c([2H])c1-c1c(-c2ccccc2)c2ccccc2c2ccccc12 |
| InChI | InChI=1S/C64H41NO/c1-3-17-42(18-4-1)50-29-15-31-58-59-32-16-30-51(64(59)66-63(50)58)43-33-37-47(38-34-43)65(60-41-46-21-7-8-22-49(46)52-23-9-12-26-55(52)60)48-39-35-45(36-40-48)62-57-28-14-11-25-54(57)53-24-10-13-27-56(53)61(62)44-19-5-2-6-20-44/h1-41H/i35D,36D,39D,40D |
| InChIKey | REAAIZLTRYCDCM-LYCLBSDYSA-N |
| XLogP | 18.34 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.06 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|