C52H35N — CID 163547387
N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenanthren-9-amine (PubChem CID 163547387) has the molecular formula C52H35N and a molecular weight of 681.91 g/mol. Its IUPAC name is N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenanthren-9-amine.
| Compound Name | N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenanthren-9-amine |
|---|---|
| PubChem CID | 163547387 |
| Molecular Formula | C52H35N |
| Molecular Weight | 681.91 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)phenanthren-9-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-c3c(-c4ccccc4)c4ccccc4c4ccccc34)c([2H])c2[2H])c2cc3ccccc3c3ccccc23)c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C52H35N/c1-3-15-36(16-4-1)37-27-31-41(32-28-37)53(50-35-40-19-7-8-20-43(40)44-21-9-12-24-47(44)50)42-33-29-39(30-34-42)52-49-26-14-11-23-46(49)45-22-10-13-25-48(45)51(52)38-17-5-2-6-18-38/h1-35H/i27D,28D,29D,30D,31D,32D,33D,34D |
| InChIKey | RKPMQGLVZCKPGU-CFGDSOPNSA-N |
| XLogP | 14.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.91 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|