C64H42N2 — CID 167419812
N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-[2,3,5-trideuterio-4-(9-phenylcarbazol-3-yl)phenyl]phenanthren-9-amine (PubChem CID 167419812) has the molecular formula C64H42N2 and a molecular weight of 846.10 g/mol. Its IUPAC name is N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-[2,3,5-trideuterio-4-(9-phenylcarbazol-3-yl)phenyl]phenanthren-9-amine.
| Compound Name | N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-[2,3,5-trideuterio-4-(9-phenylcarbazol-3-yl)phenyl]phenanthren-9-amine |
|---|---|
| PubChem CID | 167419812 |
| Molecular Formula | C64H42N2 |
| Molecular Weight | 846.10 g/mol |
| Exact Mass | 845.38 |
| IUPAC Name | N-[2,3,5,6-tetradeuterio-4-(10-phenylphenanthren-9-yl)phenyl]-N-[2,3,5-trideuterio-4-(9-phenylcarbazol-3-yl)phenyl]phenanthren-9-amine |
| SMILES | [2H]c1cc(N(c2c([2H])c([2H])c(-c3c(-c4ccccc4)c4ccccc4c4ccccc34)c([2H])c2[2H])c2cc3ccccc3c3ccccc23)c([2H])c([2H])c1-c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C64H42N2/c1-3-17-44(18-4-1)63-57-28-13-10-24-53(57)54-25-11-14-29-58(54)64(63)45-33-38-50(39-34-45)65(62-42-47-19-7-8-22-51(47)52-23-9-12-26-55(52)62)49-36-31-43(32-37-49)46-35-40-61-59(41-46)56-27-15-16-30-60(56)66(61)48-20-5-2-6-21-48/h1-42H/i31D,32D,33D,34D,36D,38D,39D |
| InChIKey | ADEYDDIPKWUPFN-WFQIDLQASA-N |
| XLogP | 17.87 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.10 |
| LogP ≤ 5 | 17.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|