C52H34N2 — CID 162481165
N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)phenanthren-9-amine (PubChem CID 162481165) has the molecular formula C52H34N2 and a molecular weight of 694.91 g/mol. Its IUPAC name is N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)phenanthren-9-amine.
| Compound Name | N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)phenanthren-9-amine |
|---|---|
| PubChem CID | 162481165 |
| Molecular Formula | C52H34N2 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | N-(4-carbazol-9-yl-2,3,5,6-tetradeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-2-ylphenyl)phenanthren-9-amine |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-n3c4ccccc4c4ccccc43)c([2H])c2[2H])c2cc3ccccc3c3ccccc23)c([2H])c([2H])c1-c1ccc2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C52H34N2/c1-3-13-43-36(11-1)21-22-39-33-37(25-32-45(39)43)35-23-26-40(27-24-35)53(52-34-38-12-2-4-14-44(38)46-15-5-6-16-47(46)52)41-28-30-42(31-29-41)54-50-19-9-7-17-48(50)49-18-8-10-20-51(49)54/h1-34H/i23D,24D,26D,27D,28D,29D,30D,31D |
| InChIKey | YWUFETIEDZZYJJ-PZXDQVHTSA-N |
| XLogP | 14.53 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|