C44H29N — CID 162481392
N-naphthalen-2-yl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine (PubChem CID 162481392) has the molecular formula C44H29N and a molecular weight of 575.75 g/mol. Its IUPAC name is N-naphthalen-2-yl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine.
| Compound Name | N-naphthalen-2-yl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine |
|---|---|
| PubChem CID | 162481392 |
| Molecular Formula | C44H29N |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | N-naphthalen-2-yl-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3ccccc3c2)c2cc3ccccc3c3ccccc23)c([2H])c([2H])c1-c1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/C44H29N/c1-2-11-34-27-38(26-23-30(34)9-1)45(44-29-36-12-4-6-14-40(36)41-15-7-8-16-42(41)44)37-24-21-31(22-25-37)35-20-19-33-18-17-32-10-3-5-13-39(32)43(33)28-35/h1-29H/i21D,22D,24D,25D |
| InChIKey | QDVDYNONTWBKSB-YVFZWGAPSA-N |
| XLogP | 12.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|