C46H31N — CID 162481325
N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenanthren-9-amine (PubChem CID 162481325) has the molecular formula C46H31N and a molecular weight of 606.82 g/mol. Its IUPAC name is N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenanthren-9-amine.
| Compound Name | N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenanthren-9-amine |
|---|---|
| PubChem CID | 162481325 |
| Molecular Formula | C46H31N |
| Molecular Weight | 606.82 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | N-(4-phenanthren-9-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenanthren-9-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(N(c3ccc(-c4cc5ccccc5c5ccccc45)cc3)c3cc4ccccc4c4ccccc34)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C46H31N/c1-2-12-32(13-3-1)33-22-26-37(27-23-33)47(46-31-36-15-5-7-17-40(36)42-19-10-11-21-44(42)46)38-28-24-34(25-29-38)45-30-35-14-4-6-16-39(35)41-18-8-9-20-43(41)45/h1-31H/i1D,2D,3D,12D,13D,22D,23D,26D,27D |
| InChIKey | XDOKUWGOZPKRGL-ZXTQWPKKSA-N |
| XLogP | 13.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.82 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|