C40H27N — CID 162481231
N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine (PubChem CID 162481231) has the molecular formula C40H27N and a molecular weight of 530.72 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine.
| Compound Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine |
|---|---|
| PubChem CID | 162481231 |
| Molecular Formula | C40H27N |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-(2,3,5,6-tetradeuterio-4-phenanthren-3-ylphenyl)phenanthren-9-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2c([2H])c([2H])c(-c3ccc4ccc5ccccc5c4c3)c([2H])c2[2H])c2cc3ccccc3c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C40H27N/c1-2-12-33(13-3-1)41(40-27-32-11-5-7-15-36(32)37-16-8-9-17-38(37)40)34-24-22-28(23-25-34)31-21-20-30-19-18-29-10-4-6-14-35(29)39(30)26-31/h1-27H/i1D,2D,3D,12D,13D,22D,23D,24D,25D |
| InChIKey | OQVVSVJSVSOZGI-QFMUVLQBSA-N |
| XLogP | 11.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|