C33H28F3N5O4S — CID 163762280
2-[3-[(8E)-19,19-dioxo-24-(trifluoromethyl)-19λ6-thia-13,20,25,26-tetrazatetracyclo[19.3.1.114,18.02,7]hexacosa-1(24),2,4,6,8,14(26),15,17,21(25),22-decaen-13-yl]propyl]isoindole-1,3-dione (PubChem CID 163762280) has the molecular formula C33H28F3N5O4S and a molecular weight of 647.68 g/mol. Its IUPAC name is 2-[3-[(8E)-19,19-dioxo-24-(trifluoromethyl)-19λ6-thia-13,20,25,26-tetrazatetracyclo[19.3.1.114,18.02,7]hexacosa-1(24),2,4,6,8,14(26),15,17,21(25),22-decaen-13-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(8E)-19,19-dioxo-24-(trifluoromethyl)-19λ6-thia-13,20,25,26-tetrazatetracyclo[19.3.1.114,18.02,7]hexacosa-1(24),2,4,6,8,14(26),15,17,21(25),22-decaen-13-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163762280 |
| Molecular Formula | C33H28F3N5O4S |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.18 |
| IUPAC Name | 2-[3-[(8E)-19,19-dioxo-24-(trifluoromethyl)-19λ6-thia-13,20,25,26-tetrazatetracyclo[19.3.1.114,18.02,7]hexacosa-1(24),2,4,6,8,14(26),15,17,21(25),22-decaen-13-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCN1CCC/C=C/c2ccccc2-c2nc(ccc2C(F)(F)F)NS(=O)(=O)c2cccc1n2 |
| InChI | InChI=1S/C33H28F3N5O4S/c34-33(35,36)26-17-18-27-37-30(26)23-12-4-3-11-22(23)10-2-1-7-19-40(28-15-8-16-29(38-28)46(44,45)39-27)20-9-21-41-31(42)24-13-5-6-14-25(24)32(41)43/h2-6,8,10-18H,1,7,9,19-21H2,(H,37,39)/b10-2+ |
| InChIKey | LZETXPGGJFQDTP-WTDSWWLTSA-N |
| XLogP | 6.26 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|