C6H5F3S — CID 163763310
3,4,5-trifluorocyclohexa-1,3-diene-1-thiol (PubChem CID 163763310) has the molecular formula C6H5F3S and a molecular weight of 166.17 g/mol. Its IUPAC name is 3,4,5-trifluorocyclohexa-1,3-diene-1-thiol.
| Compound Name | 3,4,5-trifluorocyclohexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 163763310 |
| Molecular Formula | C6H5F3S |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 3,4,5-trifluorocyclohexa-1,3-diene-1-thiol |
| SMILES | FC1=C(F)C(F)CC(S)=C1 |
| InChI | InChI=1S/C6H5F3S/c7-4-1-3(10)2-5(8)6(4)9/h1,5,10H,2H2 |
| InChIKey | MABWNFVASHGBMN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|