C7H10F2S — CID 142087634
(2Z,4E)-3,5-difluorohepta-2,4-diene-2-thiol (PubChem CID 142087634) has the molecular formula C7H10F2S and a molecular weight of 164.22 g/mol. Its IUPAC name is (2Z,4E)-3,5-difluorohepta-2,4-diene-2-thiol.
| Compound Name | (2Z,4E)-3,5-difluorohepta-2,4-diene-2-thiol |
|---|---|
| PubChem CID | 142087634 |
| Molecular Formula | C7H10F2S |
| Molecular Weight | 164.22 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | (2Z,4E)-3,5-difluorohepta-2,4-diene-2-thiol |
| SMILES | CC/C(F)=C\C(F)=C(/C)S |
| InChI | InChI=1S/C7H10F2S/c1-3-6(8)4-7(9)5(2)10/h4,10H,3H2,1-2H3/b6-4+,7-5- |
| InChIKey | XCRXXSOTZFTNAB-GUBXDBFYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|